C41H51N3O4S — CID 100573960
(2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100573960) has the molecular formula C41H51N3O4S and a molecular weight of 681.94 g/mol. Its IUPAC name is (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100573960 |
| Molecular Formula | C41H51N3O4S |
| Molecular Weight | 681.94 g/mol |
| Exact Mass | 681.36 |
| IUPAC Name | (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccccc1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C41H51N3O4S/c1-49(47,48)44(37-19-17-35(18-20-37)41-25-32-21-33(26-41)23-34(22-32)27-41)29-39(45)43(28-31-13-7-3-8-14-31)38(24-30-11-5-2-6-12-30)40(46)42-36-15-9-4-10-16-36/h2-3,5-8,11-14,17-20,32-34,36,38H,4,9-10,15-16,21-29H2,1H3,(H,42,46)/t32?,33?,34?,38-,41?/m0/s1 |
| InChIKey | GKFPPQSBJQWELS-FABKHVPFSA-N |
| XLogP | 7.01 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.94 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |