C36H49N3O4S — CID 132639141
2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide (PubChem CID 132639141) has the molecular formula C36H49N3O4S and a molecular weight of 619.87 g/mol. Its IUPAC name is 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132639141 |
| Molecular Formula | C36H49N3O4S |
| Molecular Weight | 619.87 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C36H49N3O4S/c1-3-33(35(41)37-31-12-8-5-9-13-31)38(24-26-10-6-4-7-11-26)34(40)25-39(44(2,42)43)32-16-14-30(15-17-32)36-21-27-18-28(22-36)20-29(19-27)23-36/h4,6-7,10-11,14-17,27-29,31,33H,3,5,8-9,12-13,18-25H2,1-2H3,(H,37,41) |
| InChIKey | CBCWBIILIVUMBR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |