C34H45N3O4S — CID 132634137
2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclopentylpropanamide (PubChem CID 132634137) has the molecular formula C34H45N3O4S and a molecular weight of 591.82 g/mol. Its IUPAC name is 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclopentylpropanamide.
| Compound Name | 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 132634137 |
| Molecular Formula | C34H45N3O4S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-benzylamino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C34H45N3O4S/c1-24(33(39)35-30-10-6-7-11-30)36(22-25-8-4-3-5-9-25)32(38)23-37(42(2,40)41)31-14-12-29(13-15-31)34-19-26-16-27(20-34)18-28(17-26)21-34/h3-5,8-9,12-15,24,26-28,30H,6-7,10-11,16-23H2,1-2H3,(H,35,39) |
| InChIKey | YOUZSFHYGXALOA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |