C41H50ClN3O4S — CID 100603548
(2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100603548) has the molecular formula C41H50ClN3O4S and a molecular weight of 716.39 g/mol. Its IUPAC name is (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100603548 |
| Molecular Formula | C41H50ClN3O4S |
| Molecular Weight | 716.39 g/mol |
| Exact Mass | 715.32 |
| IUPAC Name | (2S)-2-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccc(Cl)cc1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C41H50ClN3O4S/c1-50(48,49)45(37-18-14-34(15-19-37)41-24-31-20-32(25-41)22-33(21-31)26-41)28-39(46)44(27-30-12-16-35(42)17-13-30)38(23-29-8-4-2-5-9-29)40(47)43-36-10-6-3-7-11-36/h2,4-5,8-9,12-19,31-33,36,38H,3,6-7,10-11,20-28H2,1H3,(H,43,47)/t31?,32?,33?,38-,41?/m0/s1 |
| InChIKey | YNLLNLNJWUVBQG-PLKSFWFWSA-N |
| XLogP | 7.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.39 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |