C10H11NO2 — CID 10058065
(3S,4R)-3-amino-4-benzyloxetan-2-one (PubChem CID 10058065) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3S,4R)-3-amino-4-benzyloxetan-2-one.
| Compound Name | (3S,4R)-3-amino-4-benzyloxetan-2-one |
|---|---|
| PubChem CID | 10058065 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3S,4R)-3-amino-4-benzyloxetan-2-one |
| SMILES | N[C@@H]1C(=O)O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c11-9-8(13-10(9)12)6-7-4-2-1-3-5-7/h1-5,8-9H,6,11H2/t8-,9+/m1/s1 |
| InChIKey | OWVIYMMLKHNYBT-BDAKNGLRSA-N |
| XLogP | 0.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|