C18H25N3O3 — CID 100581104
N-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]piperidine-1-carboxamide (PubChem CID 100581104) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]piperidine-1-carboxamide.
| Compound Name | N-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 100581104 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[2-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c22-16-14-12-4-5-13(7-6-12)15(14)17(23)21(16)11-8-19-18(24)20-9-2-1-3-10-20/h4-5,12-15H,1-3,6-11H2,(H,19,24)/t12-,13-,14+,15+/m0/s1 |
| InChIKey | OFWNVBHOZWQORQ-BYNSBNAKSA-N |
| XLogP | 1.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|