C11H12ClNO2 — CID 100585649
5-chloro-2,3-diethoxybenzonitrile (PubChem CID 100585649) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is 5-chloro-2,3-diethoxybenzonitrile.
| Compound Name | 5-chloro-2,3-diethoxybenzonitrile |
|---|---|
| PubChem CID | 100585649 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 5-chloro-2,3-diethoxybenzonitrile |
| SMILES | CCOc1cc(Cl)cc(C#N)c1OCC |
| InChI | InChI=1S/C11H12ClNO2/c1-3-14-10-6-9(12)5-8(7-13)11(10)15-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BLHKPSLDCGBIAI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |