C15H18ClNO3 — CID 43332657
(Z)-3-chloro-3-(3,4,5-triethoxyphenyl)prop-2-enenitrile (PubChem CID 43332657) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is (Z)-3-chloro-3-(3,4,5-triethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-chloro-3-(3,4,5-triethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 43332657 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (Z)-3-chloro-3-(3,4,5-triethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C(Cl)=C/C#N)cc(OCC)c1OCC |
| InChI | InChI=1S/C15H18ClNO3/c1-4-18-13-9-11(12(16)7-8-17)10-14(19-5-2)15(13)20-6-3/h7,9-10H,4-6H2,1-3H3/b12-7- |
| InChIKey | ZCUVVKZCFSZJTF-GHXNOFRVSA-N |
| XLogP | 3.99 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|