C14H15Cl2N3OS3 — CID 100588216
2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 100588216) has the molecular formula C14H15Cl2N3OS3 and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 100588216 |
| Molecular Formula | C14H15Cl2N3OS3 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(C)Sc1nnc(NC(=O)CSCc2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C14H15Cl2N3OS3/c1-8(2)22-14-19-18-13(23-14)17-12(20)7-21-6-9-10(15)4-3-5-11(9)16/h3-5,8H,6-7H2,1-2H3,(H,17,18,20) |
| InChIKey | MQQBEZYDSWDYEE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|