C12H19N3O2 — CID 10060081
1,2-ditert-butyl-3,5-dioxopyrazolidine-4-carbonitrile (PubChem CID 10060081) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1,2-ditert-butyl-3,5-dioxopyrazolidine-4-carbonitrile.
| Compound Name | 1,2-ditert-butyl-3,5-dioxopyrazolidine-4-carbonitrile |
|---|---|
| PubChem CID | 10060081 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1,2-ditert-butyl-3,5-dioxopyrazolidine-4-carbonitrile |
| SMILES | CC(C)(C)N1C(=O)C(C#N)C(=O)N1C(C)(C)C |
| InChI | InChI=1S/C12H19N3O2/c1-11(2,3)14-9(16)8(7-13)10(17)15(14)12(4,5)6/h8H,1-6H3 |
| InChIKey | QNXIGUWKWMTVEO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|