C16H30O — CID 10060138
(3R,4S,5E)-4-tert-butyl-3,6,7,7-tetramethylocta-1,5-dien-4-ol (PubChem CID 10060138) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (3R,4S,5E)-4-tert-butyl-3,6,7,7-tetramethylocta-1,5-dien-4-ol.
| Compound Name | (3R,4S,5E)-4-tert-butyl-3,6,7,7-tetramethylocta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 10060138 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (3R,4S,5E)-4-tert-butyl-3,6,7,7-tetramethylocta-1,5-dien-4-ol |
| SMILES | C=C[C@@H](C)[C@](O)(/C=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O/c1-10-12(2)16(17,15(7,8)9)11-13(3)14(4,5)6/h10-12,17H,1H2,2-9H3/b13-11+/t12-,16-/m1/s1 |
| InChIKey | XARBSZUOQOILGU-LXEKJOJESA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|