C16H23NO4 — CID 100602846
N-(3-methoxypropyl)-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine-7-carboxamide (PubChem CID 100602846) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine-7-carboxamide.
| Compound Name | N-(3-methoxypropyl)-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine-7-carboxamide |
|---|---|
| PubChem CID | 100602846 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(3-methoxypropyl)-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine-7-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2c(c1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C16H23NO4/c1-16(2)10-20-13-6-5-12(9-14(13)21-11-16)15(18)17-7-4-8-19-3/h5-6,9H,4,7-8,10-11H2,1-3H3,(H,17,18) |
| InChIKey | FJAQCBUPTWTARV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|