C16H19NO2 — CID 10061025
benzyl (2S)-1-but-3-ynylpyrrolidine-2-carboxylate (PubChem CID 10061025) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is benzyl (2S)-1-but-3-ynylpyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-but-3-ynylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10061025 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | benzyl (2S)-1-but-3-ynylpyrrolidine-2-carboxylate |
| SMILES | C#CCCN1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-2-3-11-17-12-7-10-15(17)16(18)19-13-14-8-5-4-6-9-14/h1,4-6,8-9,15H,3,7,10-13H2/t15-/m0/s1 |
| InChIKey | MVFWNCMUXBCXGG-HNNXBMFYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|