C17H22F2N2O2S — CID 100613834
N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]pent-4-yne-1-sulfonamide (PubChem CID 100613834) has the molecular formula C17H22F2N2O2S and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]pent-4-yne-1-sulfonamide.
| Compound Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]pent-4-yne-1-sulfonamide |
|---|---|
| PubChem CID | 100613834 |
| Molecular Formula | C17H22F2N2O2S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]pent-4-yne-1-sulfonamide |
| SMILES | C#CCCCS(=O)(=O)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H22F2N2O2S/c1-2-3-4-11-24(22,23)20-15-7-9-21(10-8-15)13-14-5-6-16(18)17(19)12-14/h1,5-6,12,15,20H,3-4,7-11,13H2 |
| InChIKey | VWPROXFLRXSZLX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|