C12H17N3O2S — CID 100615398
N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 100615398) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 100615398 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | C[C@@H](Nc1ncc([N+](=O)[O-])s1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H17N3O2S/c1-7(10-5-8-2-3-9(10)4-8)14-12-13-6-11(18-12)15(16)17/h6-10H,2-5H2,1H3,(H,13,14)/t7-,8+,9+,10-/m1/s1 |
| InChIKey | MNDUFYGMJAZUIU-XFWSIPNHSA-N |
| XLogP | 3.29 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|