C19H27Cl2N3O4 — CID 100623657
tert-butyl 4-[(4-amino-3,5-dichlorophenyl)carbamoyl]-4-(methoxymethyl)piperidine-1-carboxylate (PubChem CID 100623657) has the molecular formula C19H27Cl2N3O4 and a molecular weight of 432.35 g/mol. Its IUPAC name is tert-butyl 4-[(4-amino-3,5-dichlorophenyl)carbamoyl]-4-(methoxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-amino-3,5-dichlorophenyl)carbamoyl]-4-(methoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100623657 |
| Molecular Formula | C19H27Cl2N3O4 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | tert-butyl 4-[(4-amino-3,5-dichlorophenyl)carbamoyl]-4-(methoxymethyl)piperidine-1-carboxylate |
| SMILES | COCC1(C(=O)Nc2cc(Cl)c(N)c(Cl)c2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O4/c1-18(2,3)28-17(26)24-7-5-19(6-8-24,11-27-4)16(25)23-12-9-13(20)15(22)14(21)10-12/h9-10H,5-8,11,22H2,1-4H3,(H,23,25) |
| InChIKey | SEQGIGGIIVQOOY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|