C18H32N2O6S2 — CID 166422341
3-[2-[[4-(methoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422341) has the molecular formula C18H32N2O6S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 3-[2-[[4-(methoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[4-(methoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422341 |
| Molecular Formula | C18H32N2O6S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[2-[[4-(methoxymethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | COCC1(C(=O)NCCSSCCC(=O)O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H32N2O6S2/c1-17(2,3)26-16(24)20-9-6-18(7-10-20,13-25-4)15(23)19-8-12-28-27-11-5-14(21)22/h5-13H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | REEWZKMKDIBATK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|