C18H26ClN3O3 — CID 118142608
tert-butyl 2-[(2-amino-4-chloro-3-methylphenyl)carbamoyl]-2-methylpyrrolidine-1-carboxylate (PubChem CID 118142608) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is tert-butyl 2-[(2-amino-4-chloro-3-methylphenyl)carbamoyl]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-amino-4-chloro-3-methylphenyl)carbamoyl]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118142608 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | tert-butyl 2-[(2-amino-4-chloro-3-methylphenyl)carbamoyl]-2-methylpyrrolidine-1-carboxylate |
| SMILES | Cc1c(Cl)ccc(NC(=O)C2(C)CCCN2C(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C18H26ClN3O3/c1-11-12(19)7-8-13(14(11)20)21-15(23)18(5)9-6-10-22(18)16(24)25-17(2,3)4/h7-8H,6,9-10,20H2,1-5H3,(H,21,23) |
| InChIKey | CORFQPFEGSYSRN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|