C18H27ClN4O3 — CID 150993777
tert-butyl (2S)-2-[[2-amino-3-(aminomethyl)-4-chlorophenyl]carbamoyl]-2-methylpyrrolidine-1-carboxylate (PubChem CID 150993777) has the molecular formula C18H27ClN4O3 and a molecular weight of 382.89 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-amino-3-(aminomethyl)-4-chlorophenyl]carbamoyl]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[2-amino-3-(aminomethyl)-4-chlorophenyl]carbamoyl]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150993777 |
| Molecular Formula | C18H27ClN4O3 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | tert-butyl (2S)-2-[[2-amino-3-(aminomethyl)-4-chlorophenyl]carbamoyl]-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(C)C(=O)Nc1ccc(Cl)c(CN)c1N |
| InChI | InChI=1S/C18H27ClN4O3/c1-17(2,3)26-16(25)23-9-5-8-18(23,4)15(24)22-13-7-6-12(19)11(10-20)14(13)21/h6-7H,5,8-10,20-21H2,1-4H3,(H,22,24)/t18-/m0/s1 |
| InChIKey | LSQUIECJBAGJLP-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|