C18H24N2O4 — CID 151355261
tert-butyl (2R)-2-(2-amino-3-formylbenzoyl)-2-methylpyrrolidine-1-carboxylate (PubChem CID 151355261) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-amino-3-formylbenzoyl)-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(2-amino-3-formylbenzoyl)-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151355261 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl (2R)-2-(2-amino-3-formylbenzoyl)-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]1(C)C(=O)c1cccc(C=O)c1N |
| InChI | InChI=1S/C18H24N2O4/c1-17(2,3)24-16(23)20-10-6-9-18(20,4)15(22)13-8-5-7-12(11-21)14(13)19/h5,7-8,11H,6,9-10,19H2,1-4H3/t18-/m1/s1 |
| InChIKey | ONIOCUBARIYHCF-GOSISDBHSA-N |
| XLogP | 3.05 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|