C10H10BrClN2O2S — CID 100628534
(2-bromo-5-chloro-4-pyridinyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 100628534) has the molecular formula C10H10BrClN2O2S and a molecular weight of 337.63 g/mol. Its IUPAC name is (2-bromo-5-chloro-4-pyridinyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2-bromo-5-chloro-4-pyridinyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 100628534 |
| Molecular Formula | C10H10BrClN2O2S |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | (2-bromo-5-chloro-4-pyridinyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1cc(Br)ncc1Cl)N1CCS(=O)CC1 |
| InChI | InChI=1S/C10H10BrClN2O2S/c11-9-5-7(8(12)6-13-9)10(15)14-1-3-17(16)4-2-14/h5-6H,1-4H2 |
| InChIKey | BYNPGPXXLTYJNA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|