About tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate
tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 100629934) has the molecular formula C17H23N5O3S
and a molecular weight of 377.47 g/mol. Its IUPAC name is tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 100629934 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CN(C)C(=O)c1ccnc(NCc2cnc(NC(=O)OC(C)(C)C)s2)c1 |
| InChI | InChI=1S/C17H23N5O3S/c1-17(2,3)25-16(24)21-15-20-10-12(26-15)9-19-13-8-11(6-7-18-13)14(23)22(4)5/h6-8,10H,9H2,1-5H3,(H,18,19)(H,20,21,24) |
| InChIKey | BUWQXIFOLCXRQI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate (CID 100629934) is tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate is CN(C)C(=O)c1ccnc(NCc2cnc(NC(=O)OC(C)(C)C)s2)c1.
What is the InChIKey of tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is BUWQXIFOLCXRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O3S/c1-17(2,3)25-16(24)21-15-20-10-12(26-15)9-19-13-8-11(6-7-18-13)14(23)22(4)5/h6-8,10H,9H2,1-5H3,(H,18,19)(H,20,21,24).
What are the key properties of tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 377.47 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[[[4-(dimethylcarbamoyl)-2-pyridinyl]amino]methyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 100629934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).