C30H41F2N5O6 — CID 100631258
(3S,6S,10S,11R,12S,13R,17S)-4-cyclohexyl-18-[(3,4-difluorophenyl)methyl]-11,12-dihydroxy-22-oxa-1,4,7,15,18-pentazatetracyclo[15.3.1.13,6.110,13]tricosane-2,8,16-trione (PubChem CID 100631258) has the molecular formula C30H41F2N5O6 and a molecular weight of 605.68 g/mol. Its IUPAC name is (3S,6S,10S,11R,12S,13R,17S)-4-cyclohexyl-18-[(3,4-difluorophenyl)methyl]-11,12-dihydroxy-22-oxa-1,4,7,15,18-pentazatetracyclo[15.3.1.13,6.110,13]tricosane-2,8,16-trione.
| Compound Name | (3S,6S,10S,11R,12S,13R,17S)-4-cyclohexyl-18-[(3,4-difluorophenyl)methyl]-11,12-dihydroxy-22-oxa-1,4,7,15,18-pentazatetracyclo[15.3.1.13,6.110,13]tricosane-2,8,16-trione |
|---|---|
| PubChem CID | 100631258 |
| Molecular Formula | C30H41F2N5O6 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | (3S,6S,10S,11R,12S,13R,17S)-4-cyclohexyl-18-[(3,4-difluorophenyl)methyl]-11,12-dihydroxy-22-oxa-1,4,7,15,18-pentazatetracyclo[15.3.1.13,6.110,13]tricosane-2,8,16-trione |
| SMILES | O=C1C[C@@H]2O[C@H](CNC(=O)[C@@H]3CN(CCN3Cc3ccc(F)c(F)c3)C(=O)[C@@H]3C[C@@H](CN3C3CCCCC3)N1)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C30H41F2N5O6/c31-20-7-6-17(10-21(20)32)14-35-8-9-36-16-23(35)29(41)33-13-25-28(40)27(39)24(43-25)12-26(38)34-18-11-22(30(36)42)37(15-18)19-4-2-1-3-5-19/h6-7,10,18-19,22-25,27-28,39-40H,1-5,8-9,11-16H2,(H,33,41)(H,34,38)/t18-,22-,23-,24-,25+,27-,28+/m0/s1 |
| InChIKey | KBKNCAGAUVVWFK-XCROLPLHSA-N |
| XLogP | -0.12 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |