C30H37N3O5 — CID 125416034
(1R,5S,8S,20S,23S)-6-cyclobutyl-23-hydroxy-14-phenyl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione (PubChem CID 125416034) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-6-cyclobutyl-23-hydroxy-14-phenyl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-6-cyclobutyl-23-hydroxy-14-phenyl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 125416034 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | (1R,5S,8S,20S,23S)-6-cyclobutyl-23-hydroxy-14-phenyl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
| SMILES | O=C1N[C@H]2C[C@@H](C(=O)NC[C@H]3O[C@H](CCOc4cc(-c5ccccc5)ccc41)CC[C@@H]3O)N(C1CCC1)C2 |
| InChI | InChI=1S/C30H37N3O5/c34-26-12-10-23-13-14-37-27-15-20(19-5-2-1-3-6-19)9-11-24(27)29(35)32-21-16-25(30(36)31-17-28(26)38-23)33(18-21)22-7-4-8-22/h1-3,5-6,9,11,15,21-23,25-26,28,34H,4,7-8,10,12-14,16-18H2,(H,31,36)(H,32,35)/t21-,23-,25-,26-,28+/m0/s1 |
| InChIKey | YPNXCWIKDZHKHK-QIXRUXETSA-N |
| XLogP | 2.89 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |