C31H43F2N3O5 — CID 125415794
(1R,5S,8S,20S,23S)-14-cyclopentyl-6-(4,4-difluorocyclohexyl)-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione (PubChem CID 125415794) has the molecular formula C31H43F2N3O5 and a molecular weight of 575.70 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-14-cyclopentyl-6-(4,4-difluorocyclohexyl)-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-14-cyclopentyl-6-(4,4-difluorocyclohexyl)-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 125415794 |
| Molecular Formula | C31H43F2N3O5 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | (1R,5S,8S,20S,23S)-14-cyclopentyl-6-(4,4-difluorocyclohexyl)-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
| SMILES | O=C1N[C@H]2C[C@@H](C(=O)NC[C@H]3O[C@H](CCOc4cc(C5CCCC5)ccc41)CC[C@@H]3O)N(C1CCC(F)(F)CC1)C2 |
| InChI | InChI=1S/C31H43F2N3O5/c32-31(33)12-9-22(10-13-31)36-18-21-16-25(36)30(39)34-17-28-26(37)8-6-23(41-28)11-14-40-27-15-20(19-3-1-2-4-19)5-7-24(27)29(38)35-21/h5,7,15,19,21-23,25-26,28,37H,1-4,6,8-14,16-18H2,(H,34,39)(H,35,38)/t21-,23-,25-,26-,28+/m0/s1 |
| InChIKey | CSXHMQDFDRZPKU-QIXRUXETSA-N |
| XLogP | 3.90 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |