C31H41N5O5 — CID 125416027
(1R,5S,8S,20S,23S)-23-hydroxy-6-(1-methylpiperidin-4-yl)-14-pyridin-4-yl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione (PubChem CID 125416027) has the molecular formula C31H41N5O5 and a molecular weight of 563.70 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-23-hydroxy-6-(1-methylpiperidin-4-yl)-14-pyridin-4-yl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-23-hydroxy-6-(1-methylpiperidin-4-yl)-14-pyridin-4-yl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 125416027 |
| Molecular Formula | C31H41N5O5 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | (1R,5S,8S,20S,23S)-23-hydroxy-6-(1-methylpiperidin-4-yl)-14-pyridin-4-yl-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
| SMILES | CN1CCC(N2C[C@@H]3C[C@H]2C(=O)NC[C@H]2O[C@H](CCOc4cc(-c5ccncc5)ccc4C(=O)N3)CC[C@@H]2O)CC1 |
| InChI | InChI=1S/C31H41N5O5/c1-35-13-8-23(9-14-35)36-19-22-17-26(36)31(39)33-18-29-27(37)5-3-24(41-29)10-15-40-28-16-21(20-6-11-32-12-7-20)2-4-25(28)30(38)34-22/h2,4,6-7,11-12,16,22-24,26-27,29,37H,3,5,8-10,13-15,17-19H2,1H3,(H,33,39)(H,34,38)/t22-,24-,26-,27-,29+/m0/s1 |
| InChIKey | YALLABQJKJZWBO-USJHEHEUSA-N |
| XLogP | 1.82 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |