C32H46N4O6 — CID 125416041
(1R,5S,8S,20S,23S)-6-(1-acetylpiperidin-4-yl)-14-cyclopentyl-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione (PubChem CID 125416041) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-6-(1-acetylpiperidin-4-yl)-14-cyclopentyl-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-6-(1-acetylpiperidin-4-yl)-14-cyclopentyl-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 125416041 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | (1R,5S,8S,20S,23S)-6-(1-acetylpiperidin-4-yl)-14-cyclopentyl-23-hydroxy-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
| SMILES | CC(=O)N1CCC(N2C[C@@H]3C[C@H]2C(=O)NC[C@H]2O[C@H](CCOc4cc(C5CCCC5)ccc4C(=O)N3)CC[C@@H]2O)CC1 |
| InChI | InChI=1S/C32H46N4O6/c1-20(37)35-13-10-24(11-14-35)36-19-23-17-27(36)32(40)33-18-30-28(38)9-7-25(42-30)12-15-41-29-16-22(21-4-2-3-5-21)6-8-26(29)31(39)34-23/h6,8,16,21,23-25,27-28,30,38H,2-5,7,9-15,17-19H2,1H3,(H,33,40)(H,34,39)/t23-,25-,27-,28-,30+/m0/s1 |
| InChIKey | ZIVSLULFKPEHAO-IKJZKLLOSA-N |
| XLogP | 2.34 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |