C25H35N3O7 — CID 125415919
tert-butyl (1R,5S,8S,20S,23S)-23-hydroxy-4,10-dioxo-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-6-carboxylate (PubChem CID 125415919) has the molecular formula C25H35N3O7 and a molecular weight of 489.57 g/mol. Its IUPAC name is tert-butyl (1R,5S,8S,20S,23S)-23-hydroxy-4,10-dioxo-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-6-carboxylate.
| Compound Name | tert-butyl (1R,5S,8S,20S,23S)-23-hydroxy-4,10-dioxo-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-6-carboxylate |
|---|---|
| PubChem CID | 125415919 |
| Molecular Formula | C25H35N3O7 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | tert-butyl (1R,5S,8S,20S,23S)-23-hydroxy-4,10-dioxo-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C(=O)NC[C@H]1O[C@H](CCOc3ccccc3C(=O)N2)CC[C@@H]1O |
| InChI | InChI=1S/C25H35N3O7/c1-25(2,3)35-24(32)28-14-15-12-18(28)23(31)26-13-21-19(29)9-8-16(34-21)10-11-33-20-7-5-4-6-17(20)22(30)27-15/h4-7,15-16,18-19,21,29H,8-14H2,1-3H3,(H,26,31)(H,27,30)/t15-,16-,18-,19-,21+/m0/s1 |
| InChIKey | NGGQNDICRAPUEY-HKWIXDGRSA-N |
| XLogP | 1.60 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |