C28H35N3O7S — CID 122165081
(1R,5S,21S,24S)-24-hydroxy-7-[(4-methylsulfonylphenyl)methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione (PubChem CID 122165081) has the molecular formula C28H35N3O7S and a molecular weight of 557.67 g/mol. Its IUPAC name is (1R,5S,21S,24S)-24-hydroxy-7-[(4-methylsulfonylphenyl)methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24S)-24-hydroxy-7-[(4-methylsulfonylphenyl)methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
|---|---|
| PubChem CID | 122165081 |
| Molecular Formula | C28H35N3O7S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (1R,5S,21S,24S)-24-hydroxy-7-[(4-methylsulfonylphenyl)methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-triene-4,11-dione |
| SMILES | CS(=O)(=O)c1ccc(CN2CCN3C(=O)c4ccccc4OCC[C@@H]4CC[C@H](O)[C@@H](CNC(=O)[C@@H]3C2)O4)cc1 |
| InChI | InChI=1S/C28H35N3O7S/c1-39(35,36)21-9-6-19(7-10-21)17-30-13-14-31-23(18-30)27(33)29-16-26-24(32)11-8-20(38-26)12-15-37-25-5-3-2-4-22(25)28(31)34/h2-7,9-10,20,23-24,26,32H,8,11-18H2,1H3,(H,29,33)/t20-,23-,24-,26+/m0/s1 |
| InChIKey | GTJYVRAOLWUMNZ-OAFYVUHTSA-N |
| XLogP | 1.22 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |