C31H38N4O8 — CID 122165241
N-[(1R,5S,21S,24R)-7-(1,3-benzodioxol-5-ylmethyl)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-2-methoxyacetamide (PubChem CID 122165241) has the molecular formula C31H38N4O8 and a molecular weight of 594.67 g/mol. Its IUPAC name is N-[(1R,5S,21S,24R)-7-(1,3-benzodioxol-5-ylmethyl)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-2-methoxyacetamide.
| Compound Name | N-[(1R,5S,21S,24R)-7-(1,3-benzodioxol-5-ylmethyl)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 122165241 |
| Molecular Formula | C31H38N4O8 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | N-[(1R,5S,21S,24R)-7-(1,3-benzodioxol-5-ylmethyl)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H]1CC[C@H]2CCOc3ccccc3C(=O)N3CCN(Cc4ccc5c(c4)OCO5)C[C@H]3C(=O)NC[C@H]1O2 |
| InChI | InChI=1S/C31H38N4O8/c1-39-18-29(36)33-23-8-7-21-10-13-40-25-5-3-2-4-22(25)31(38)35-12-11-34(17-24(35)30(37)32-15-28(23)43-21)16-20-6-9-26-27(14-20)42-19-41-26/h2-6,9,14,21,23-24,28H,7-8,10-13,15-19H2,1H3,(H,32,37)(H,33,36)/t21-,23+,24-,28+/m0/s1 |
| InChIKey | YIYNAJYADQZBHV-DSZDGCDSSA-N |
| XLogP | 1.32 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |