C24H34N4O6 — CID 122165223
2-methoxy-N-[(1R,5S,21S,24R)-7-methyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide (PubChem CID 122165223) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-methoxy-N-[(1R,5S,21S,24R)-7-methyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide.
| Compound Name | 2-methoxy-N-[(1R,5S,21S,24R)-7-methyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide |
|---|---|
| PubChem CID | 122165223 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-methoxy-N-[(1R,5S,21S,24R)-7-methyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide |
| SMILES | COCC(=O)N[C@@H]1CC[C@H]2CCOc3ccccc3C(=O)N3CCN(C)C[C@H]3C(=O)NC[C@H]1O2 |
| InChI | InChI=1S/C24H34N4O6/c1-27-10-11-28-19(14-27)23(30)25-13-21-18(26-22(29)15-32-2)8-7-16(34-21)9-12-33-20-6-4-3-5-17(20)24(28)31/h3-6,16,18-19,21H,7-15H2,1-2H3,(H,25,30)(H,26,29)/t16-,18+,19-,21+/m0/s1 |
| InChIKey | DHJIOFPXRHFIDX-GZMOKQHVSA-N |
| XLogP | 0.02 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |