C26H36N4O5 — CID 122165397
N-[(1R,5S,21S,24R)-7-cyclobutyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide (PubChem CID 122165397) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[(1R,5S,21S,24R)-7-cyclobutyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide.
| Compound Name | N-[(1R,5S,21S,24R)-7-cyclobutyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide |
|---|---|
| PubChem CID | 122165397 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | N-[(1R,5S,21S,24R)-7-cyclobutyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC[C@H]2CCOc3ccccc3C(=O)N3CCN(C4CCC4)C[C@H]3C(=O)NC[C@H]1O2 |
| InChI | InChI=1S/C26H36N4O5/c1-17(31)28-21-10-9-19-11-14-34-23-8-3-2-7-20(23)26(33)30-13-12-29(18-5-4-6-18)16-22(30)25(32)27-15-24(21)35-19/h2-3,7-8,18-19,21-22,24H,4-6,9-16H2,1H3,(H,27,32)(H,28,31)/t19-,21+,22-,24+/m0/s1 |
| InChIKey | RDWKHKSPGYLIBZ-AYEXWZOKSA-N |
| XLogP | 1.32 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |