C33H44N4O5 — CID 122165259
N-[(1R,5S,21S,24R)-7-benzyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-3,3-dimethylbutanamide (PubChem CID 122165259) has the molecular formula C33H44N4O5 and a molecular weight of 576.74 g/mol. Its IUPAC name is N-[(1R,5S,21S,24R)-7-benzyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[(1R,5S,21S,24R)-7-benzyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 122165259 |
| Molecular Formula | C33H44N4O5 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | N-[(1R,5S,21S,24R)-7-benzyl-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N[C@@H]1CC[C@H]2CCOc3ccccc3C(=O)N3CCN(Cc4ccccc4)C[C@H]3C(=O)NC[C@H]1O2 |
| InChI | InChI=1S/C33H44N4O5/c1-33(2,3)19-30(38)35-26-14-13-24-15-18-41-28-12-8-7-11-25(28)32(40)37-17-16-36(21-23-9-5-4-6-10-23)22-27(37)31(39)34-20-29(26)42-24/h4-12,24,26-27,29H,13-22H2,1-3H3,(H,34,39)(H,35,38)/t24-,26+,27-,29+/m0/s1 |
| InChIKey | OZVIUWHYPOTXBO-DXLYGPJMSA-N |
| XLogP | 3.38 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |