C33H37N3O5 — CID 122165383
(1R,5S,21S,24S)-7-benzyl-24-hydroxy-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione (PubChem CID 122165383) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is (1R,5S,21S,24S)-7-benzyl-24-hydroxy-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24S)-7-benzyl-24-hydroxy-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
|---|---|
| PubChem CID | 122165383 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (1R,5S,21S,24S)-7-benzyl-24-hydroxy-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
| SMILES | O=C1NC[C@H]2O[C@H](CCOc3cc(-c4ccccc4)ccc3C(=O)N3CCN(Cc4ccccc4)C[C@@H]13)CC[C@@H]2O |
| InChI | InChI=1S/C33H37N3O5/c37-29-14-12-26-15-18-40-30-19-25(24-9-5-2-6-10-24)11-13-27(30)33(39)36-17-16-35(21-23-7-3-1-4-8-23)22-28(36)32(38)34-20-31(29)41-26/h1-11,13,19,26,28-29,31,37H,12,14-18,20-22H2,(H,34,38)/t26-,28-,29-,31+/m0/s1 |
| InChIKey | CJYWBZJLOHITNV-YQOCYVMFSA-N |
| XLogP | 3.49 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |