C25H33N5O5 — CID 122165100
(1R,5S,21S,24S)-24-hydroxy-7-methyl-15-(1-methylpyrazol-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione (PubChem CID 122165100) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is (1R,5S,21S,24S)-24-hydroxy-7-methyl-15-(1-methylpyrazol-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24S)-24-hydroxy-7-methyl-15-(1-methylpyrazol-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
|---|---|
| PubChem CID | 122165100 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (1R,5S,21S,24S)-24-hydroxy-7-methyl-15-(1-methylpyrazol-4-yl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
| SMILES | CN1CCN2C(=O)c3ccc(-c4cnn(C)c4)cc3OCC[C@@H]3CC[C@H](O)[C@@H](CNC(=O)[C@@H]2C1)O3 |
| InChI | InChI=1S/C25H33N5O5/c1-28-8-9-30-20(15-28)24(32)26-13-23-21(31)6-4-18(35-23)7-10-34-22-11-16(3-5-19(22)25(30)33)17-12-27-29(2)14-17/h3,5,11-12,14,18,20-21,23,31H,4,6-10,13,15H2,1-2H3,(H,26,32)/t18-,20-,21-,23+/m0/s1 |
| InChIKey | UMPVCGYYCSMWBC-XHRGMSINSA-N |
| XLogP | 0.65 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |