C29H35N5O5S — CID 125415860
(1R,5S,8S,20S,23S)-23-hydroxy-14-(1-methylpyrazol-4-yl)-6-(thiophen-2-ylmethyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione (PubChem CID 125415860) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-23-hydroxy-14-(1-methylpyrazol-4-yl)-6-(thiophen-2-ylmethyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-23-hydroxy-14-(1-methylpyrazol-4-yl)-6-(thiophen-2-ylmethyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
|---|---|
| PubChem CID | 125415860 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (1R,5S,8S,20S,23S)-23-hydroxy-14-(1-methylpyrazol-4-yl)-6-(thiophen-2-ylmethyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11(16),12,14-triene-4,10-dione |
| SMILES | Cn1cc(-c2ccc3c(c2)OCC[C@@H]2CC[C@H](O)[C@@H](CNC(=O)[C@@H]4C[C@@H](CN4Cc4cccs4)NC3=O)O2)cn1 |
| InChI | InChI=1S/C29H35N5O5S/c1-33-15-19(13-31-33)18-4-6-23-26(11-18)38-9-8-21-5-7-25(35)27(39-21)14-30-29(37)24-12-20(32-28(23)36)16-34(24)17-22-3-2-10-40-22/h2-4,6,10-11,13,15,20-21,24-25,27,35H,5,7-9,12,14,16-17H2,1H3,(H,30,37)(H,32,36)/t20-,21-,24-,25-,27+/m0/s1 |
| InChIKey | HUPHGQAJEDQOCL-IXUQPJALSA-N |
| XLogP | 2.33 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |