C31H39N3O7 — CID 122165462
tert-butyl (1R,5S,21S,24S)-24-hydroxy-4,11-dioxo-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-7-carboxylate (PubChem CID 122165462) has the molecular formula C31H39N3O7 and a molecular weight of 565.67 g/mol. Its IUPAC name is tert-butyl (1R,5S,21S,24S)-24-hydroxy-4,11-dioxo-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-7-carboxylate.
| Compound Name | tert-butyl (1R,5S,21S,24S)-24-hydroxy-4,11-dioxo-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-7-carboxylate |
|---|---|
| PubChem CID | 122165462 |
| Molecular Formula | C31H39N3O7 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | tert-butyl (1R,5S,21S,24S)-24-hydroxy-4,11-dioxo-15-phenyl-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)c3ccc(-c4ccccc4)cc3OCC[C@@H]3CC[C@H](O)[C@@H](CNC(=O)[C@@H]2C1)O3 |
| InChI | InChI=1S/C31H39N3O7/c1-31(2,3)41-30(38)33-14-15-34-24(19-33)28(36)32-18-27-25(35)12-10-22(40-27)13-16-39-26-17-21(9-11-23(26)29(34)37)20-7-5-4-6-8-20/h4-9,11,17,22,24-25,27,35H,10,12-16,18-19H2,1-3H3,(H,32,36)/t22-,24-,25-,27+/m0/s1 |
| InChIKey | FEGTWTFHSCHPHT-WVAUJHLCSA-N |
| XLogP | 3.22 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |