C34H36F3N3O6 — CID 122165391
(1R,5S,21S,24S)-24-hydroxy-15-phenyl-7-[[4-(trifluoromethoxy)phenyl]methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione (PubChem CID 122165391) has the molecular formula C34H36F3N3O6 and a molecular weight of 639.67 g/mol. Its IUPAC name is (1R,5S,21S,24S)-24-hydroxy-15-phenyl-7-[[4-(trifluoromethoxy)phenyl]methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione.
| Compound Name | (1R,5S,21S,24S)-24-hydroxy-15-phenyl-7-[[4-(trifluoromethoxy)phenyl]methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
|---|---|
| PubChem CID | 122165391 |
| Molecular Formula | C34H36F3N3O6 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | (1R,5S,21S,24S)-24-hydroxy-15-phenyl-7-[[4-(trifluoromethoxy)phenyl]methyl]-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12(17),13,15-triene-4,11-dione |
| SMILES | O=C1NC[C@H]2O[C@H](CCOc3cc(-c4ccccc4)ccc3C(=O)N3CCN(Cc4ccc(OC(F)(F)F)cc4)C[C@@H]13)CC[C@@H]2O |
| InChI | InChI=1S/C34H36F3N3O6/c35-34(36,37)46-26-9-6-22(7-10-26)20-39-15-16-40-28(21-39)32(42)38-19-31-29(41)13-11-25(45-31)14-17-44-30-18-24(8-12-27(30)33(40)43)23-4-2-1-3-5-23/h1-10,12,18,25,28-29,31,41H,11,13-17,19-21H2,(H,38,42)/t25-,28-,29-,31+/m0/s1 |
| InChIKey | CDPVIYPACBSOIL-WFKKSYCUSA-N |
| XLogP | 4.39 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |