C28H31N3O6 — CID 122165148
4-[[(1S,5S,21S)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16,23-tetraen-7-yl]methyl]benzoic acid (PubChem CID 122165148) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[[(1S,5S,21S)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16,23-tetraen-7-yl]methyl]benzoic acid.
| Compound Name | 4-[[(1S,5S,21S)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16,23-tetraen-7-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122165148 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[[(1S,5S,21S)-4,11-dioxo-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16,23-tetraen-7-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCN3C(=O)c4ccccc4OCC[C@@H]4CC=C[C@@H](CNC(=O)[C@@H]3C2)O4)cc1 |
| InChI | InChI=1S/C28H31N3O6/c32-26-24-18-30(17-19-8-10-20(11-9-19)28(34)35)13-14-31(24)27(33)23-6-1-2-7-25(23)36-15-12-21-4-3-5-22(37-21)16-29-26/h1-3,5-11,21-22,24H,4,12-18H2,(H,29,32)(H,34,35)/t21-,22-,24-/m0/s1 |
| InChIKey | SBYKJOILHCQSAP-FIXSFTCYSA-N |
| XLogP | 2.32 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|