C31H40N4O6S — CID 122165288
N-[(1R,5S,21S,24R)-4,11-dioxo-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]oxane-4-carboxamide (PubChem CID 122165288) has the molecular formula C31H40N4O6S and a molecular weight of 596.75 g/mol. Its IUPAC name is N-[(1R,5S,21S,24R)-4,11-dioxo-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]oxane-4-carboxamide.
| Compound Name | N-[(1R,5S,21S,24R)-4,11-dioxo-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 122165288 |
| Molecular Formula | C31H40N4O6S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | N-[(1R,5S,21S,24R)-4,11-dioxo-7-(thiophen-3-ylmethyl)-18,25-dioxa-3,7,10-triazatetracyclo[19.3.1.05,10.012,17]pentacosa-12,14,16-trien-24-yl]oxane-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@H]2CCOc3ccccc3C(=O)N3CCN(Cc4ccsc4)C[C@H]3C(=O)NC[C@H]1O2)C1CCOCC1 |
| InChI | InChI=1S/C31H40N4O6S/c36-29(22-7-13-39-14-8-22)33-25-6-5-23-9-15-40-27-4-2-1-3-24(27)31(38)35-12-11-34(18-21-10-16-42-20-21)19-26(35)30(37)32-17-28(25)41-23/h1-4,10,16,20,22-23,25-26,28H,5-9,11-15,17-19H2,(H,32,37)(H,33,36)/t23-,25+,26-,28+/m0/s1 |
| InChIKey | YCNAGCVCLZUGTC-JGDRUYDSSA-N |
| XLogP | 2.43 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |