C27H39N3O5 — CID 125415840
(1R,5S,8S,20S,23S)-23-hydroxy-6-(4-methylcyclohexyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-4,10-dione (PubChem CID 125415840) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is (1R,5S,8S,20S,23S)-23-hydroxy-6-(4-methylcyclohexyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-4,10-dione.
| Compound Name | (1R,5S,8S,20S,23S)-23-hydroxy-6-(4-methylcyclohexyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-4,10-dione |
|---|---|
| PubChem CID | 125415840 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (1R,5S,8S,20S,23S)-23-hydroxy-6-(4-methylcyclohexyl)-17,24-dioxa-3,6,9-triazatetracyclo[18.3.1.15,8.011,16]pentacosa-11,13,15-triene-4,10-dione |
| SMILES | CC1CCC(N2C[C@@H]3C[C@H]2C(=O)NC[C@H]2O[C@H](CCOc4ccccc4C(=O)N3)CC[C@@H]2O)CC1 |
| InChI | InChI=1S/C27H39N3O5/c1-17-6-8-19(9-7-17)30-16-18-14-22(30)27(33)28-15-25-23(31)11-10-20(35-25)12-13-34-24-5-3-2-4-21(24)26(32)29-18/h2-5,17-20,22-23,25,31H,6-16H2,1H3,(H,28,33)(H,29,32)/t17?,18-,19?,20-,22-,23-,25+/m0/s1 |
| InChIKey | GJEOQKCMWMUBMS-OUWNFZQOSA-N |
| XLogP | 2.25 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |