C21H21N5O6 — CID 100632929
N-[3-(2,5-dioxoimidazolidin-1-yl)-4-methylphenyl]-2-morpholin-4-yl-3-nitrobenzamide (PubChem CID 100632929) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[3-(2,5-dioxoimidazolidin-1-yl)-4-methylphenyl]-2-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[3-(2,5-dioxoimidazolidin-1-yl)-4-methylphenyl]-2-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 100632929 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[3-(2,5-dioxoimidazolidin-1-yl)-4-methylphenyl]-2-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2N2CCOCC2)cc1N1C(=O)CNC1=O |
| InChI | InChI=1S/C21H21N5O6/c1-13-5-6-14(11-17(13)25-18(27)12-22-21(25)29)23-20(28)15-3-2-4-16(26(30)31)19(15)24-7-9-32-10-8-24/h2-6,11H,7-10,12H2,1H3,(H,22,29)(H,23,28) |
| InChIKey | BFGHANKSDCOJON-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|