C14H16F3N3O4 — CID 86782454
2-morpholin-4-yl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 86782454) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-morpholin-4-yl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2-morpholin-4-yl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 86782454 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-morpholin-4-yl-3-nitro-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1cccc([N+](=O)[O-])c1N1CCOCC1 |
| InChI | InChI=1S/C14H16F3N3O4/c15-14(16,17)4-5-18-13(21)10-2-1-3-11(20(22)23)12(10)19-6-8-24-9-7-19/h1-3H,4-9H2,(H,18,21) |
| InChIKey | XCRAVTJPHURPOY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|