C13H19F2N3O2S — CID 100637513
4-(3,4-difluorophenyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide (PubChem CID 100637513) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-(3,4-difluorophenyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 100637513 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCN(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H19F2N3O2S/c1-16(2)21(19,20)18-7-3-6-17(8-9-18)11-4-5-12(14)13(15)10-11/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | ZNGPURCOIWVPSN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |