C20H24N2O — CID 10063885
trans-(1R,2R)-2-[benzyl-[(E)-benzylideneamino]amino]cyclohexan-1-ol (PubChem CID 10063885) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is trans-(1R,2R)-2-[benzyl-[(E)-benzylideneamino]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[benzyl-[(E)-benzylideneamino]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10063885 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | trans-(1R,2R)-2-[benzyl-[(E)-benzylideneamino]amino]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1N(Cc1ccccc1)/N=C/c1ccccc1 |
| InChI | InChI=1S/C20H24N2O/c23-20-14-8-7-13-19(20)22(16-18-11-5-2-6-12-18)21-15-17-9-3-1-4-10-17/h1-6,9-12,15,19-20,23H,7-8,13-14,16H2/b21-15+/t19-,20-/m1/s1 |
| InChIKey | DIUCHZHXATZDKY-GWBOOFJZSA-N |
| XLogP | 3.83 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|