C19H18O5 — CID 10064939
7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3-methylchromen-2-one (PubChem CID 10064939) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3-methylchromen-2-one.
| Compound Name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3-methylchromen-2-one |
|---|---|
| PubChem CID | 10064939 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3-methylchromen-2-one |
| SMILES | Cc1cc2ccc(OC/C=C/C3=CC(=O)C(C)(C)O3)cc2oc1=O |
| InChI | InChI=1S/C19H18O5/c1-12-9-13-6-7-14(10-16(13)23-18(12)21)22-8-4-5-15-11-17(20)19(2,3)24-15/h4-7,9-11H,8H2,1-3H3/b5-4+ |
| InChIKey | CHXMFWDKTPCGAG-SNAWJCMRSA-N |
| XLogP | 3.30 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|