C20H20O5 — CID 11382228
7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3,4-dimethylchromen-2-one (PubChem CID 11382228) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 11382228 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 7-[(E)-3-(5,5-dimethyl-4-oxofuran-2-yl)prop-2-enoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OC/C=C/C3=CC(=O)C(C)(C)O3)cc2oc1=O |
| InChI | InChI=1S/C20H20O5/c1-12-13(2)19(22)24-17-10-14(7-8-16(12)17)23-9-5-6-15-11-18(21)20(3,4)25-15/h5-8,10-11H,9H2,1-4H3/b6-5+ |
| InChIKey | YBJSUOSSLURUTL-AATRIKPKSA-N |
| XLogP | 3.61 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|