C24H36N2O5 — CID 100661657
2-[(2S,3aR,5R,6R,6aR)-6-hydroxy-5-[[[(1R,3R)-3-methylcyclohexyl]amino]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 100661657) has the molecular formula C24H36N2O5 and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-[(2S,3aR,5R,6R,6aR)-6-hydroxy-5-[[[(1R,3R)-3-methylcyclohexyl]amino]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(2S,3aR,5R,6R,6aR)-6-hydroxy-5-[[[(1R,3R)-3-methylcyclohexyl]amino]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 100661657 |
| Molecular Formula | C24H36N2O5 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[(2S,3aR,5R,6R,6aR)-6-hydroxy-5-[[[(1R,3R)-3-methylcyclohexyl]amino]methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)C[C@@H]2C[C@H]3O[C@H](CN[C@@H]4CCC[C@@H](C)C4)[C@@H](O)[C@H]3O2)cc1 |
| InChI | InChI=1S/C24H36N2O5/c1-15-4-3-5-17(10-15)25-14-21-23(28)24-20(31-21)11-19(30-24)12-22(27)26-13-16-6-8-18(29-2)9-7-16/h6-9,15,17,19-21,23-25,28H,3-5,10-14H2,1-2H3,(H,26,27)/t15-,17-,19+,20-,21-,23-,24+/m1/s1 |
| InChIKey | DCWNLFIHGAMSMK-NQMYJEJVSA-N |
| XLogP | 2.16 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |