C24H28FN3O5 — CID 162802173
2-[5-[(benzylcarbamoylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 162802173) has the molecular formula C24H28FN3O5 and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[5-[(benzylcarbamoylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[5-[(benzylcarbamoylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 162802173 |
| Molecular Formula | C24H28FN3O5 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[5-[(benzylcarbamoylamino)methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CC1CC2OC(CNC(=O)NCc3ccccc3)C(O)C2O1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H28FN3O5/c25-17-8-6-16(7-9-17)12-26-21(29)11-18-10-19-23(32-18)22(30)20(33-19)14-28-24(31)27-13-15-4-2-1-3-5-15/h1-9,18-20,22-23,30H,10-14H2,(H,26,29)(H2,27,28,31) |
| InChIKey | KNHXBUJWAMHPEI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |