C31H34F2N2O5 — CID 162931473
2-[5-[[bis[(4-fluorophenyl)methyl]amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 162931473) has the molecular formula C31H34F2N2O5 and a molecular weight of 552.62 g/mol. Its IUPAC name is 2-[5-[[bis[(4-fluorophenyl)methyl]amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[5-[[bis[(4-fluorophenyl)methyl]amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 162931473 |
| Molecular Formula | C31H34F2N2O5 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2-[5-[[bis[(4-fluorophenyl)methyl]amino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CC2CC3OC(CN(Cc4ccc(F)cc4)Cc4ccc(F)cc4)C(O)C3O2)cc1 |
| InChI | InChI=1S/C31H34F2N2O5/c1-38-25-12-6-20(7-13-25)16-34-29(36)15-26-14-27-31(39-26)30(37)28(40-27)19-35(17-21-2-8-23(32)9-3-21)18-22-4-10-24(33)11-5-22/h2-13,26-28,30-31,37H,14-19H2,1H3,(H,34,36) |
| InChIKey | KWUVFMNKFQNSJG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |